C27H31ClN4OSSi — CID 175179706
9-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2-chloro-7H-purine-8-thione (PubChem CID 175179706) has the molecular formula C27H31ClN4OSSi and a molecular weight of 523.18 g/mol. Its IUPAC name is 9-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2-chloro-7H-purine-8-thione.
| Compound Name | 9-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2-chloro-7H-purine-8-thione |
|---|---|
| PubChem CID | 175179706 |
| Molecular Formula | C27H31ClN4OSSi |
| Molecular Weight | 523.18 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 9-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]-2-chloro-7H-purine-8-thione |
| SMILES | CC(C)(C)[Si](OC1CCC(n2c(=S)[nH]c3cnc(Cl)nc32)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31ClN4OSSi/c1-27(2,3)35(21-10-6-4-7-11-21,22-12-8-5-9-13-22)33-20-16-14-19(15-17-20)32-24-23(30-26(32)34)18-29-25(28)31-24/h4-13,18-20H,14-17H2,1-3H3,(H,30,34) |
| InChIKey | OESMUUNWGXMECW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.18 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|