C40H42N8O9 — CID 175221523
[2-(5-tert-butyl-1,2-oxazol-3-yl)-4-[5-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]benzimidazol-1-yl]phenyl]urea (PubChem CID 175221523) has the molecular formula C40H42N8O9 and a molecular weight of 778.82 g/mol. Its IUPAC name is [2-(5-tert-butyl-1,2-oxazol-3-yl)-4-[5-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]benzimidazol-1-yl]phenyl]urea.
| Compound Name | [2-(5-tert-butyl-1,2-oxazol-3-yl)-4-[5-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]benzimidazol-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 175221523 |
| Molecular Formula | C40H42N8O9 |
| Molecular Weight | 778.82 g/mol |
| Exact Mass | 778.31 |
| IUPAC Name | [2-(5-tert-butyl-1,2-oxazol-3-yl)-4-[5-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]benzimidazol-1-yl]phenyl]urea |
| SMILES | CC(C)(C)c1cc(-c2cc(-n3cnc4cc(OCCOCCOCCNc5cccc6c5C(=O)N(C5CCC(=O)NC5=O)C6=O)ccc43)ccc2NC(N)=O)no1 |
| InChI | InChI=1S/C40H42N8O9/c1-40(2,3)33-21-29(46-57-33)26-19-23(7-9-27(26)44-39(41)53)47-22-43-30-20-24(8-10-31(30)47)56-18-17-55-16-15-54-14-13-42-28-6-4-5-25-35(28)38(52)48(37(25)51)32-11-12-34(49)45-36(32)50/h4-10,19-22,32,42H,11-18H2,1-3H3,(H3,41,44,53)(H,45,49,50) |
| InChIKey | AJRHWYUSEAFAFM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 222.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|