C14H10ClF3N2O6S — CID 175242095
2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]-4-methylsulfonyloxypyrrole-1-carboxylic acid (PubChem CID 175242095) has the molecular formula C14H10ClF3N2O6S and a molecular weight of 426.76 g/mol. Its IUPAC name is 2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]-4-methylsulfonyloxypyrrole-1-carboxylic acid.
| Compound Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]-4-methylsulfonyloxypyrrole-1-carboxylic acid |
|---|---|
| PubChem CID | 175242095 |
| Molecular Formula | C14H10ClF3N2O6S |
| Molecular Weight | 426.76 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]-4-methylsulfonyloxypyrrole-1-carboxylic acid |
| SMILES | CS(=O)(=O)Oc1cc(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)n(C(=O)O)c1 |
| InChI | InChI=1S/C14H10ClF3N2O6S/c1-27(24,25)26-8-5-11(20(6-8)13(22)23)12(21)19-7-2-3-10(15)9(4-7)14(16,17)18/h2-6H,1H3,(H,19,21)(H,22,23) |
| InChIKey | YZQPGTGELQVLEY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.76 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|