About adamantane;2-bromoacetaldehyde
adamantane;2-bromoacetaldehyde (PubChem CID 175315145) has the molecular formula C12H19BrO
and a molecular weight of 259.19 g/mol. Its IUPAC name is adamantane;2-bromoacetaldehyde.
Molecular Properties
| Compound Name | adamantane;2-bromoacetaldehyde |
| PubChem CID | 175315145 |
| Molecular Formula | C12H19BrO |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | adamantane;2-bromoacetaldehyde |
| SMILES | C1C2CC3CC1CC(C2)C3.O=CCBr |
| InChI | InChI=1S/C10H16.C2H3BrO/c1-7-2-9-4-8(1)5-10(3-7)6-9;3-1-2-4/h7-10H,1-6H2;2H,1H2 |
| InChIKey | BMODVQUHHSPVSB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze adamantane;2-bromoacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;2-bromoacetaldehyde?
The IUPAC name of adamantane;2-bromoacetaldehyde (CID 175315145) is adamantane;2-bromoacetaldehyde.
What is the SMILES notation for adamantane;2-bromoacetaldehyde?
The canonical SMILES for adamantane;2-bromoacetaldehyde is C1C2CC3CC1CC(C2)C3.O=CCBr.
What is the InChIKey of adamantane;2-bromoacetaldehyde?
The InChIKey is BMODVQUHHSPVSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C2H3BrO/c1-7-2-9-4-8(1)5-10(3-7)6-9;3-1-2-4/h7-10H,1-6H2;2H,1H2.
What are the key properties of adamantane;2-bromoacetaldehyde?
adamantane;2-bromoacetaldehyde has a molecular weight of 259.19 g/mol, XLogP of 3.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;2-bromoacetaldehyde is sourced from PubChem (CID 175315145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).