About bicyclo[2.2.1]heptane;2-fluoroacetaldehyde
bicyclo[2.2.1]heptane;2-fluoroacetaldehyde (PubChem CID 45123092) has the molecular formula C9H15FO
and a molecular weight of 158.22 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane;2-fluoroacetaldehyde.
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptane;2-fluoroacetaldehyde |
| PubChem CID | 45123092 |
| Molecular Formula | C9H15FO |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | bicyclo[2.2.1]heptane;2-fluoroacetaldehyde |
| SMILES | C1CC2CCC1C2.O=CCF |
| InChI | InChI=1S/C7H12.C2H3FO/c1-2-7-4-3-6(1)5-7;3-1-2-4/h6-7H,1-5H2;2H,1H2 |
| InChIKey | KXFFIPXVEQYDQP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]heptane;2-fluoroacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptane;2-fluoroacetaldehyde?
The IUPAC name of bicyclo[2.2.1]heptane;2-fluoroacetaldehyde (CID 45123092) is bicyclo[2.2.1]heptane;2-fluoroacetaldehyde.
What is the SMILES notation for bicyclo[2.2.1]heptane;2-fluoroacetaldehyde?
The canonical SMILES for bicyclo[2.2.1]heptane;2-fluoroacetaldehyde is C1CC2CCC1C2.O=CCF.
What is the InChIKey of bicyclo[2.2.1]heptane;2-fluoroacetaldehyde?
The InChIKey is KXFFIPXVEQYDQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.C2H3FO/c1-2-7-4-3-6(1)5-7;3-1-2-4/h6-7H,1-5H2;2H,1H2.
What are the key properties of bicyclo[2.2.1]heptane;2-fluoroacetaldehyde?
bicyclo[2.2.1]heptane;2-fluoroacetaldehyde has a molecular weight of 158.22 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptane;2-fluoroacetaldehyde is sourced from PubChem (CID 45123092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).