C24H50N4 — CID 175373024
1,1-bis(1,2,2,3-tetramethylpiperidin-4-yl)hexylhydrazine (PubChem CID 175373024) has the molecular formula C24H50N4 and a molecular weight of 394.69 g/mol. Its IUPAC name is 1,1-bis(1,2,2,3-tetramethylpiperidin-4-yl)hexylhydrazine.
| Compound Name | 1,1-bis(1,2,2,3-tetramethylpiperidin-4-yl)hexylhydrazine |
|---|---|
| PubChem CID | 175373024 |
| Molecular Formula | C24H50N4 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.40 |
| IUPAC Name | 1,1-bis(1,2,2,3-tetramethylpiperidin-4-yl)hexylhydrazine |
| SMILES | CCCCCC(NN)(C1CCN(C)C(C)(C)C1C)C1CCN(C)C(C)(C)C1C |
| InChI | InChI=1S/C24H50N4/c1-10-11-12-15-24(26-25,20-13-16-27(8)22(4,5)18(20)2)21-14-17-28(9)23(6,7)19(21)3/h18-21,26H,10-17,25H2,1-9H3 |
| InChIKey | WXGFFMZUTUPWQP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|