C6H5N5OS — CID 175378183
(2-amino-1,3-thiazol-4-yl)methoxy-cyanocyanamide (PubChem CID 175378183) has the molecular formula C6H5N5OS and a molecular weight of 195.21 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-4-yl)methoxy-cyanocyanamide.
| Compound Name | (2-amino-1,3-thiazol-4-yl)methoxy-cyanocyanamide |
|---|---|
| PubChem CID | 175378183 |
| Molecular Formula | C6H5N5OS |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | (2-amino-1,3-thiazol-4-yl)methoxy-cyanocyanamide |
| SMILES | N#CN(C#N)OCc1csc(N)n1 |
| InChI | InChI=1S/C6H5N5OS/c7-3-11(4-8)12-1-5-2-13-6(9)10-5/h2H,1H2,(H2,9,10) |
| InChIKey | RYVYYXYIWJMNTF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|