C22H21N5 — CID 175393379
2,2-diphenyl-1,3-dihydroindole-4,6-dicarboximidamide (PubChem CID 175393379) has the molecular formula C22H21N5 and a molecular weight of 355.45 g/mol. Its IUPAC name is 2,2-diphenyl-1,3-dihydroindole-4,6-dicarboximidamide.
| Compound Name | 2,2-diphenyl-1,3-dihydroindole-4,6-dicarboximidamide |
|---|---|
| PubChem CID | 175393379 |
| Molecular Formula | C22H21N5 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2,2-diphenyl-1,3-dihydroindole-4,6-dicarboximidamide |
| SMILES | [H]/N=C(\N)c1cc2c(c(/C(N)=N/[H])c1)CC(c1ccccc1)(c1ccccc1)N2 |
| InChI | InChI=1S/C22H21N5/c23-20(24)14-11-17(21(25)26)18-13-22(27-19(18)12-14,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,27H,13H2,(H3,23,24)(H3,25,26) |
| InChIKey | VCXSCSPIVVLHEH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|