C17H13N3O3S — CID 175467810
5-(4-aminophenyl)-6-methylimino-2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,8(12),9-tetraen-7-one (PubChem CID 175467810) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 5-(4-aminophenyl)-6-methylimino-2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,8(12),9-tetraen-7-one.
| Compound Name | 5-(4-aminophenyl)-6-methylimino-2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,8(12),9-tetraen-7-one |
|---|---|
| PubChem CID | 175467810 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 5-(4-aminophenyl)-6-methylimino-2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,8(12),9-tetraen-7-one |
| SMILES | C/N=C1\C(=O)c2cccc3c2C(=C1c1ccc(N)cc1)NS3(=O)=O |
| InChI | InChI=1S/C17H13N3O3S/c1-19-16-13(9-5-7-10(18)8-6-9)15-14-11(17(16)21)3-2-4-12(14)24(22,23)20-15/h2-8,20H,18H2,1H3/b19-16- |
| InChIKey | KEDQJLFBLVKCPL-MNDPQUGUSA-N |
| XLogP | 1.70 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|