C8H7IN2O2S — CID 135923355
4-iodo-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 135923355) has the molecular formula C8H7IN2O2S and a molecular weight of 322.13 g/mol. Its IUPAC name is 4-iodo-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | 4-iodo-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 135923355 |
| Molecular Formula | C8H7IN2O2S |
| Molecular Weight | 322.13 g/mol |
| Exact Mass | 321.93 |
| IUPAC Name | 4-iodo-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | C/N=C1\NS(=O)(=O)c2cccc(I)c21 |
| InChI | InChI=1S/C8H7IN2O2S/c1-10-8-7-5(9)3-2-4-6(7)14(12,13)11-8/h2-4H,1H3,(H,10,11) |
| InChIKey | RHVSESYQGOHUBV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.13 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|