About 3-aminobenzaldehyde;naphthalen-2-ol
3-aminobenzaldehyde;naphthalen-2-ol (PubChem CID 175504039) has the molecular formula C17H15NO2
and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-aminobenzaldehyde;naphthalen-2-ol.
Molecular Properties
| Compound Name | 3-aminobenzaldehyde;naphthalen-2-ol |
| PubChem CID | 175504039 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-aminobenzaldehyde;naphthalen-2-ol |
| SMILES | Nc1cccc(C=O)c1.Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8O.C7H7NO/c11-10-6-5-8-3-1-2-4-9(8)7-10;8-7-3-1-2-6(4-7)5-9/h1-7,11H;1-5H,8H2 |
| InChIKey | AHJNHGZPAOAIIP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobenzaldehyde;naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobenzaldehyde;naphthalen-2-ol?
The IUPAC name of 3-aminobenzaldehyde;naphthalen-2-ol (CID 175504039) is 3-aminobenzaldehyde;naphthalen-2-ol.
What is the SMILES notation for 3-aminobenzaldehyde;naphthalen-2-ol?
The canonical SMILES for 3-aminobenzaldehyde;naphthalen-2-ol is Nc1cccc(C=O)c1.Oc1ccc2ccccc2c1.
What is the InChIKey of 3-aminobenzaldehyde;naphthalen-2-ol?
The InChIKey is AHJNHGZPAOAIIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C7H7NO/c11-10-6-5-8-3-1-2-4-9(8)7-10;8-7-3-1-2-6(4-7)5-9/h1-7,11H;1-5H,8H2.
What are the key properties of 3-aminobenzaldehyde;naphthalen-2-ol?
3-aminobenzaldehyde;naphthalen-2-ol has a molecular weight of 265.31 g/mol, XLogP of 3.63, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobenzaldehyde;naphthalen-2-ol is sourced from PubChem (CID 175504039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).