About 2-methylpropane-1,1-diol;trichlororhodium
2-methylpropane-1,1-diol;trichlororhodium (PubChem CID 175510243) has the molecular formula C4H10Cl3O2Rh
and a molecular weight of 299.39 g/mol. Its IUPAC name is 2-methylpropane-1,1-diol;trichlororhodium.
Molecular Properties
| Compound Name | 2-methylpropane-1,1-diol;trichlororhodium |
| PubChem CID | 175510243 |
| Molecular Formula | C4H10Cl3O2Rh |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 297.88 |
| IUPAC Name | 2-methylpropane-1,1-diol;trichlororhodium |
| SMILES | CC(C)C(O)O.Cl[Rh](Cl)Cl |
| InChI | InChI=1S/C4H10O2.3ClH.Rh/c1-3(2)4(5)6;;;;/h3-6H,1-2H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | AMYMFOPNSFNDAV-UHFFFAOYSA-K |
| XLogP | 2.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane-1,1-diol;trichlororhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane-1,1-diol;trichlororhodium?
The IUPAC name of 2-methylpropane-1,1-diol;trichlororhodium (CID 175510243) is 2-methylpropane-1,1-diol;trichlororhodium.
What is the SMILES notation for 2-methylpropane-1,1-diol;trichlororhodium?
The canonical SMILES for 2-methylpropane-1,1-diol;trichlororhodium is CC(C)C(O)O.Cl[Rh](Cl)Cl.
What is the InChIKey of 2-methylpropane-1,1-diol;trichlororhodium?
The InChIKey is AMYMFOPNSFNDAV-UHFFFAOYSA-K. The full InChI is InChI=1S/C4H10O2.3ClH.Rh/c1-3(2)4(5)6;;;;/h3-6H,1-2H3;3*1H;/q;;;;+3/p-3.
What are the key properties of 2-methylpropane-1,1-diol;trichlororhodium?
2-methylpropane-1,1-diol;trichlororhodium has a molecular weight of 299.39 g/mol, XLogP of 2.02, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane-1,1-diol;trichlororhodium is sourced from PubChem (CID 175510243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).