C16H18LiO5P — CID 175565104
lithium;benzene;phosphono 2,4,6-trimethylbenzoate (PubChem CID 175565104) has the molecular formula C16H18LiO5P and a molecular weight of 328.23 g/mol. Its IUPAC name is lithium;benzene;phosphono 2,4,6-trimethylbenzoate.
| Compound Name | lithium;benzene;phosphono 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 175565104 |
| Molecular Formula | C16H18LiO5P |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | lithium;benzene;phosphono 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OP(=O)(O)O)c(C)c1.[Li+].[c-]1ccccc1 |
| InChI | InChI=1S/C10H13O5P.C6H5.Li/c1-6-4-7(2)9(8(3)5-6)10(11)15-16(12,13)14;1-2-4-6-5-3-1;/h4-5H,1-3H3,(H2,12,13,14);1-5H;/q;-1;+1 |
| InChIKey | IZLRESQAGLDTEN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|