C9H17F3NO6P — CID 175589405
2-[(2-methylpropan-2-yl)oxy-(1,2,2-trifluoroethoxy)phosphoryl]oxyethyl carbamate (PubChem CID 175589405) has the molecular formula C9H17F3NO6P and a molecular weight of 323.20 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy-(1,2,2-trifluoroethoxy)phosphoryl]oxyethyl carbamate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy-(1,2,2-trifluoroethoxy)phosphoryl]oxyethyl carbamate |
|---|---|
| PubChem CID | 175589405 |
| Molecular Formula | C9H17F3NO6P |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy-(1,2,2-trifluoroethoxy)phosphoryl]oxyethyl carbamate |
| SMILES | CC(C)(C)OP(=O)(OCCOC(N)=O)OC(F)C(F)F |
| InChI | InChI=1S/C9H17F3NO6P/c1-9(2,3)19-20(15,18-7(12)6(10)11)17-5-4-16-8(13)14/h6-7H,4-5H2,1-3H3,(H2,13,14) |
| InChIKey | LBVUWGVWVXMYRZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|