About 5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole
5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole (PubChem CID 175615007) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole.
Molecular Properties
| Compound Name | 5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole |
| PubChem CID | 175615007 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole |
| SMILES | CCCC(C)(CC)c1cc2occc2[nH]1 |
| InChI | InChI=1S/C13H19NO/c1-4-7-13(3,5-2)12-9-11-10(14-12)6-8-15-11/h6,8-9,14H,4-5,7H2,1-3H3 |
| InChIKey | VSSWBUKSVALZGD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole?
The IUPAC name of 5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole (CID 175615007) is 5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole.
What is the SMILES notation for 5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole?
The canonical SMILES for 5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole is CCCC(C)(CC)c1cc2occc2[nH]1.
What is the InChIKey of 5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole?
The InChIKey is VSSWBUKSVALZGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-4-7-13(3,5-2)12-9-11-10(14-12)6-8-15-11/h6,8-9,14H,4-5,7H2,1-3H3.
What are the key properties of 5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole?
5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole has a molecular weight of 205.30 g/mol, XLogP of 4.23, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methylhexan-3-yl)-4H-furo[3,2-b]pyrrole is sourced from PubChem (CID 175615007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).