C13H13Br — CID 175695774
[5-(bromomethyl)cyclohexa-2,4-dien-1-yl]benzene (PubChem CID 175695774) has the molecular formula C13H13Br and a molecular weight of 249.15 g/mol. Its IUPAC name is [5-(bromomethyl)cyclohexa-2,4-dien-1-yl]benzene.
| Compound Name | [5-(bromomethyl)cyclohexa-2,4-dien-1-yl]benzene |
|---|---|
| PubChem CID | 175695774 |
| Molecular Formula | C13H13Br |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | [5-(bromomethyl)cyclohexa-2,4-dien-1-yl]benzene |
| SMILES | BrCC1=CC=CC(c2ccccc2)C1 |
| InChI | InChI=1S/C13H13Br/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-8,13H,9-10H2 |
| InChIKey | CCZZYDBBNVNMOH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|