C13H11F3 — CID 175695808
[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene (PubChem CID 175695808) has the molecular formula C13H11F3 and a molecular weight of 224.23 g/mol. Its IUPAC name is [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene.
| Compound Name | [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene |
|---|---|
| PubChem CID | 175695808 |
| Molecular Formula | C13H11F3 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene |
| SMILES | FC(F)(F)C1=CC=CC(c2ccccc2)C1 |
| InChI | InChI=1S/C13H11F3/c14-13(15,16)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-8,11H,9H2 |
| InChIKey | GAWBKHLTKOHZEE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |