About [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene
[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene (PubChem CID 175695808) has the molecular formula C13H11F3
and a molecular weight of 224.23 g/mol. Its IUPAC name is [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene.
Molecular Properties
| Compound Name | [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene |
| PubChem CID | 175695808 |
| Molecular Formula | C13H11F3 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene |
| SMILES | FC(F)(F)C1=CC=CC(c2ccccc2)C1 |
| InChI | InChI=1S/C13H11F3/c14-13(15,16)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-8,11H,9H2 |
| InChIKey | GAWBKHLTKOHZEE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene?
The IUPAC name of [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene (CID 175695808) is [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene.
What is the SMILES notation for [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene?
The canonical SMILES for [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene is FC(F)(F)C1=CC=CC(c2ccccc2)C1.
What is the InChIKey of [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene?
The InChIKey is GAWBKHLTKOHZEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3/c14-13(15,16)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-8,11H,9H2.
What are the key properties of [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene?
[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene has a molecular weight of 224.23 g/mol, XLogP of 4.22, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]benzene is sourced from PubChem (CID 175695808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).