C25H26F3N5O5 — CID 175809488
4-[7-methoxy-2-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]quinazolin-6-yl]-2-methylpiperidine-1-carboxylic acid (PubChem CID 175809488) has the molecular formula C25H26F3N5O5 and a molecular weight of 533.51 g/mol. Its IUPAC name is 4-[7-methoxy-2-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]quinazolin-6-yl]-2-methylpiperidine-1-carboxylic acid.
| Compound Name | 4-[7-methoxy-2-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]quinazolin-6-yl]-2-methylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175809488 |
| Molecular Formula | C25H26F3N5O5 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 4-[7-methoxy-2-[1-[3-nitro-5-(trifluoromethyl)phenyl]ethylamino]quinazolin-6-yl]-2-methylpiperidine-1-carboxylic acid |
| SMILES | COc1cc2nc(NC(C)c3cc([N+](=O)[O-])cc(C(F)(F)F)c3)ncc2cc1C1CCN(C(=O)O)C(C)C1 |
| InChI | InChI=1S/C25H26F3N5O5/c1-13-6-15(4-5-32(13)24(34)35)20-9-17-12-29-23(31-21(17)11-22(20)38-3)30-14(2)16-7-18(25(26,27)28)10-19(8-16)33(36)37/h7-15H,4-6H2,1-3H3,(H,34,35)(H,29,30,31) |
| InChIKey | YFJYPVLEWDXDNF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 130.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|