C18H18F3N5O3 — CID 175748878
7-methoxy-3-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-2H-pyrido[3,4-d]pyridazin-1-amine (PubChem CID 175748878) has the molecular formula C18H18F3N5O3 and a molecular weight of 409.37 g/mol. Its IUPAC name is 7-methoxy-3-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-2H-pyrido[3,4-d]pyridazin-1-amine.
| Compound Name | 7-methoxy-3-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-2H-pyrido[3,4-d]pyridazin-1-amine |
|---|---|
| PubChem CID | 175748878 |
| Molecular Formula | C18H18F3N5O3 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 7-methoxy-3-methyl-N-[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]-2H-pyrido[3,4-d]pyridazin-1-amine |
| SMILES | COc1cc2c(cn1)=CN(C)NC=2N[C@H](C)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3N5O3/c1-10(11-4-13(18(19,20)21)6-14(5-11)26(27)28)23-17-15-7-16(29-3)22-8-12(15)9-25(2)24-17/h4-10,23-24H,1-3H3/t10-/m1/s1 |
| InChIKey | AEGVUHDFYIAPOE-SNVBAGLBSA-N |
| XLogP | 1.62 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|