C22H35NSi3 — CID 175827398
4-[1-(4-dimethylsilylphenyl)ethenyl]-N,N-bis(trimethylsilyl)aniline (PubChem CID 175827398) has the molecular formula C22H35NSi3 and a molecular weight of 397.79 g/mol. Its IUPAC name is 4-[1-(4-dimethylsilylphenyl)ethenyl]-N,N-bis(trimethylsilyl)aniline.
| Compound Name | 4-[1-(4-dimethylsilylphenyl)ethenyl]-N,N-bis(trimethylsilyl)aniline |
|---|---|
| PubChem CID | 175827398 |
| Molecular Formula | C22H35NSi3 |
| Molecular Weight | 397.79 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 4-[1-(4-dimethylsilylphenyl)ethenyl]-N,N-bis(trimethylsilyl)aniline |
| SMILES | C=C(c1ccc(N([Si](C)(C)C)[Si](C)(C)C)cc1)c1ccc([SiH](C)C)cc1 |
| InChI | InChI=1S/C22H35NSi3/c1-18(20-12-16-22(17-13-20)24(2)3)19-10-14-21(15-11-19)23(25(4,5)6)26(7,8)9/h10-17,24H,1H2,2-9H3 |
| InChIKey | JPLGXYNZLGTGKI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.79 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|