C32H40O10 — CID 175853595
2-(2-ethyl-5-oxohexoxy)carbonylbenzoic acid;3-(2-ethyl-5-oxohexyl)phthalic acid (PubChem CID 175853595) has the molecular formula C32H40O10 and a molecular weight of 584.66 g/mol. Its IUPAC name is 2-(2-ethyl-5-oxohexoxy)carbonylbenzoic acid;3-(2-ethyl-5-oxohexyl)phthalic acid.
| Compound Name | 2-(2-ethyl-5-oxohexoxy)carbonylbenzoic acid;3-(2-ethyl-5-oxohexyl)phthalic acid |
|---|---|
| PubChem CID | 175853595 |
| Molecular Formula | C32H40O10 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 2-(2-ethyl-5-oxohexoxy)carbonylbenzoic acid;3-(2-ethyl-5-oxohexyl)phthalic acid |
| SMILES | CCC(CCC(C)=O)COC(=O)c1ccccc1C(=O)O.CCC(CCC(C)=O)Cc1cccc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/2C16H20O5/c1-3-11(8-7-10(2)17)9-12-5-4-6-13(15(18)19)14(12)16(20)21;1-3-12(9-8-11(2)17)10-21-16(20)14-7-5-4-6-13(14)15(18)19/h4-6,11H,3,7-9H2,1-2H3,(H,18,19)(H,20,21);4-7,12H,3,8-10H2,1-2H3,(H,18,19) |
| InChIKey | OQPMOCLGKKXBBE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 172.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |