About 2H-triazolo[4,5-c]isoquinolin-5-amine
2H-triazolo[4,5-c]isoquinolin-5-amine (PubChem CID 175853907) has the molecular formula C9H7N5
and a molecular weight of 185.19 g/mol. Its IUPAC name is 2H-triazolo[4,5-c]isoquinolin-5-amine.
Molecular Properties
| Compound Name | 2H-triazolo[4,5-c]isoquinolin-5-amine |
| PubChem CID | 175853907 |
| Molecular Formula | C9H7N5 |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2H-triazolo[4,5-c]isoquinolin-5-amine |
| SMILES | Nc1nc2n[nH]nc2c2ccccc12 |
| InChI | InChI=1S/C9H7N5/c10-8-6-4-2-1-3-5(6)7-9(11-8)13-14-12-7/h1-4H,(H3,10,11,12,13,14) |
| InChIKey | RSMIZFOUUIHPPK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-triazolo[4,5-c]isoquinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-triazolo[4,5-c]isoquinolin-5-amine?
The IUPAC name of 2H-triazolo[4,5-c]isoquinolin-5-amine (CID 175853907) is 2H-triazolo[4,5-c]isoquinolin-5-amine.
What is the SMILES notation for 2H-triazolo[4,5-c]isoquinolin-5-amine?
The canonical SMILES for 2H-triazolo[4,5-c]isoquinolin-5-amine is Nc1nc2n[nH]nc2c2ccccc12.
What is the InChIKey of 2H-triazolo[4,5-c]isoquinolin-5-amine?
The InChIKey is RSMIZFOUUIHPPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5/c10-8-6-4-2-1-3-5(6)7-9(11-8)13-14-12-7/h1-4H,(H3,10,11,12,13,14).
What are the key properties of 2H-triazolo[4,5-c]isoquinolin-5-amine?
2H-triazolo[4,5-c]isoquinolin-5-amine has a molecular weight of 185.19 g/mol, XLogP of 1.09, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-triazolo[4,5-c]isoquinolin-5-amine is sourced from PubChem (CID 175853907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).