C25H25F2N3O4 — CID 175893655
[1-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-3-phenylcyclobutyl] carbamate (PubChem CID 175893655) has the molecular formula C25H25F2N3O4 and a molecular weight of 469.49 g/mol. Its IUPAC name is [1-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-3-phenylcyclobutyl] carbamate.
| Compound Name | [1-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-3-phenylcyclobutyl] carbamate |
|---|---|
| PubChem CID | 175893655 |
| Molecular Formula | C25H25F2N3O4 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | [1-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-3-phenylcyclobutyl] carbamate |
| SMILES | NC(=O)OC1(C2CN(c3cc(F)c(C4CCC(=O)NC4=O)c(F)c3)C2)CC(c2ccccc2)C1 |
| InChI | InChI=1S/C25H25F2N3O4/c26-19-8-17(9-20(27)22(19)18-6-7-21(31)29-23(18)32)30-12-16(13-30)25(34-24(28)33)10-15(11-25)14-4-2-1-3-5-14/h1-5,8-9,15-16,18H,6-7,10-13H2,(H2,28,33)(H,29,31,32) |
| InChIKey | UJGBVKICHJPUPY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|