C20H22N6O8 — CID 175959400
(2R,3R,4S,5R)-2-[2-amino-6-hydroxy-6-[(2-nitro-5-prop-2-ynoxyphenyl)methyl]-3H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 175959400) has the molecular formula C20H22N6O8 and a molecular weight of 474.43 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2-amino-6-hydroxy-6-[(2-nitro-5-prop-2-ynoxyphenyl)methyl]-3H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[2-amino-6-hydroxy-6-[(2-nitro-5-prop-2-ynoxyphenyl)methyl]-3H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 175959400 |
| Molecular Formula | C20H22N6O8 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2-amino-6-hydroxy-6-[(2-nitro-5-prop-2-ynoxyphenyl)methyl]-3H-purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C#CCOc1ccc([N+](=O)[O-])c(CC2(O)N=C(N)Nc3c2ncn3[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C20H22N6O8/c1-2-5-33-11-3-4-12(26(31)32)10(6-11)7-20(30)16-17(23-19(21)24-20)25(9-22-16)18-15(29)14(28)13(8-27)34-18/h1,3-4,6,9,13-15,18,27-30H,5,7-8H2,(H3,21,23,24)/t13-,14-,15-,18-,20?/m1/s1 |
| InChIKey | GTVZHYFDJPDZML-FSXPKSEBSA-N |
| XLogP | -1.46 |
| TPSA | 210.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|