C3H5Cl3N4 — CID 176524428
2,2,2-trichloro-N-(diaminomethylidene)ethanimidamide (PubChem CID 176524428) has the molecular formula C3H5Cl3N4 and a molecular weight of 203.46 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(diaminomethylidene)ethanimidamide.
| Compound Name | 2,2,2-trichloro-N-(diaminomethylidene)ethanimidamide |
|---|---|
| PubChem CID | 176524428 |
| Molecular Formula | C3H5Cl3N4 |
| Molecular Weight | 203.46 g/mol |
| Exact Mass | 201.96 |
| IUPAC Name | 2,2,2-trichloro-N-(diaminomethylidene)ethanimidamide |
| SMILES | [H]/N=C(\N=C(N)N)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C3H5Cl3N4/c4-3(5,6)1(7)10-2(8)9/h(H5,7,8,9,10) |
| InChIKey | QFYAHNCCMKXMDJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.46 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|