C25H30ClN3O5 — CID 176528961
3-[2-chloro-3-methoxy-4-[3-[[2-oxo-1-(spiro[3.3]heptan-2-ylmethoxy)ethenyl]amino]azetidin-1-yl]phenyl]piperidine-2,6-dione (PubChem CID 176528961) has the molecular formula C25H30ClN3O5 and a molecular weight of 487.98 g/mol. Its IUPAC name is 3-[2-chloro-3-methoxy-4-[3-[[2-oxo-1-(spiro[3.3]heptan-2-ylmethoxy)ethenyl]amino]azetidin-1-yl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[2-chloro-3-methoxy-4-[3-[[2-oxo-1-(spiro[3.3]heptan-2-ylmethoxy)ethenyl]amino]azetidin-1-yl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176528961 |
| Molecular Formula | C25H30ClN3O5 |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 3-[2-chloro-3-methoxy-4-[3-[[2-oxo-1-(spiro[3.3]heptan-2-ylmethoxy)ethenyl]amino]azetidin-1-yl]phenyl]piperidine-2,6-dione |
| SMILES | COc1c(N2CC(NC(=C=O)OCC3CC4(CCC4)C3)C2)ccc(C2CCC(=O)NC2=O)c1Cl |
| InChI | InChI=1S/C25H30ClN3O5/c1-33-23-19(5-3-17(22(23)26)18-4-6-20(31)28-24(18)32)29-11-16(12-29)27-21(13-30)34-14-15-9-25(10-15)7-2-8-25/h3,5,15-16,18,27H,2,4,6-12,14H2,1H3,(H,28,31,32) |
| InChIKey | YJZYSJZJXYKXIY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|