C15H22F6O5 — CID 176591349
3,3,4,4,5,5-hexafluoro-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-2-methylcyclopentene (PubChem CID 176591349) has the molecular formula C15H22F6O5 and a molecular weight of 396.32 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-2-methylcyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-2-methylcyclopentene |
|---|---|
| PubChem CID | 176591349 |
| Molecular Formula | C15H22F6O5 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-2-methylcyclopentene |
| SMILES | COCCOCCOCCOCCOC1=C(C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H22F6O5/c1-11-12(14(18,19)15(20,21)13(11,16)17)26-10-9-25-8-7-24-6-5-23-4-3-22-2/h3-10H2,1-2H3 |
| InChIKey | UAYDUISAEDICAA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|