C30H37F2O6S2- — CID 176603017
2,6-difluoro-3-(2,4,6-tricyclohexylphenyl)sulfonyloxybenzenesulfonate (PubChem CID 176603017) has the molecular formula C30H37F2O6S2- and a molecular weight of 595.75 g/mol. Its IUPAC name is 2,6-difluoro-3-(2,4,6-tricyclohexylphenyl)sulfonyloxybenzenesulfonate.
| Compound Name | 2,6-difluoro-3-(2,4,6-tricyclohexylphenyl)sulfonyloxybenzenesulfonate |
|---|---|
| PubChem CID | 176603017 |
| Molecular Formula | C30H37F2O6S2- |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | 2,6-difluoro-3-(2,4,6-tricyclohexylphenyl)sulfonyloxybenzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)ccc(OS(=O)(=O)c2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c1F |
| InChI | InChI=1S/C30H38F2O6S2/c31-26-16-17-27(28(32)30(26)39(33,34)35)38-40(36,37)29-24(21-12-6-2-7-13-21)18-23(20-10-4-1-5-11-20)19-25(29)22-14-8-3-9-15-22/h16-22H,1-15H2,(H,33,34,35)/p-1 |
| InChIKey | QKCFKZJWZXCCSN-UHFFFAOYSA-M |
| XLogP | 7.78 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|