C16H21N5O3S — CID 176704193
(Z)-2-amino-N,N-dimethyl-3-[1-(2-nitrophenyl)sulfanyl-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enamide (PubChem CID 176704193) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is (Z)-2-amino-N,N-dimethyl-3-[1-(2-nitrophenyl)sulfanyl-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enamide.
| Compound Name | (Z)-2-amino-N,N-dimethyl-3-[1-(2-nitrophenyl)sulfanyl-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 176704193 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (Z)-2-amino-N,N-dimethyl-3-[1-(2-nitrophenyl)sulfanyl-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enamide |
| SMILES | CN(C)C(=O)/C(N)=C/C1=NCCCN(Sc2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H21N5O3S/c1-19(2)16(22)13(17)10-12-11-20(9-5-8-18-12)25-15-7-4-3-6-14(15)21(23)24/h3-4,6-7,10H,5,8-9,11,17H2,1-2H3/b13-10- |
| InChIKey | ZFCSWJDOXFDBAL-RAXLEYEMSA-N |
| XLogP | 1.68 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|