C14H16N4O3S — CID 177033408
(Z)-2-amino-3-[1-(2-nitrophenyl)sulfanyl-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enal (PubChem CID 177033408) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is (Z)-2-amino-3-[1-(2-nitrophenyl)sulfanyl-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enal.
| Compound Name | (Z)-2-amino-3-[1-(2-nitrophenyl)sulfanyl-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enal |
|---|---|
| PubChem CID | 177033408 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (Z)-2-amino-3-[1-(2-nitrophenyl)sulfanyl-2,5,6,7-tetrahydro-1,4-diazepin-3-yl]prop-2-enal |
| SMILES | N/C(C=O)=C\C1=NCCCN(Sc2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C14H16N4O3S/c15-11(10-19)8-12-9-17(7-3-6-16-12)22-14-5-2-1-4-13(14)18(20)21/h1-2,4-5,8,10H,3,6-7,9,15H2/b11-8- |
| InChIKey | CXJLBTFHRTVGJZ-FLIBITNWSA-N |
| XLogP | 1.79 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|