C13H16N2O4S2 — CID 86248659
methylsulfanylmethyl 1-(2-nitrophenyl)sulfanylpyrrolidine-2-carboxylate (PubChem CID 86248659) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is methylsulfanylmethyl 1-(2-nitrophenyl)sulfanylpyrrolidine-2-carboxylate.
| Compound Name | methylsulfanylmethyl 1-(2-nitrophenyl)sulfanylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 86248659 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | methylsulfanylmethyl 1-(2-nitrophenyl)sulfanylpyrrolidine-2-carboxylate |
| SMILES | CSCOC(=O)C1CCCN1Sc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N2O4S2/c1-20-9-19-13(16)11-6-4-8-14(11)21-12-7-3-2-5-10(12)15(17)18/h2-3,5,7,11H,4,6,8-9H2,1H3 |
| InChIKey | ZRPKWVCQCVPASP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|