C29H37N5O7 — CID 176804065
tert-butyl (NZ)-N-[[2-[(8-ethenyl-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl)methyl]-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (PubChem CID 176804065) has the molecular formula C29H37N5O7 and a molecular weight of 567.64 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[[2-[(8-ethenyl-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl)methyl]-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[[2-[(8-ethenyl-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl)methyl]-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 176804065 |
| Molecular Formula | C29H37N5O7 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | tert-butyl (NZ)-N-[[2-[(8-ethenyl-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl)methyl]-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| SMILES | C=Cc1ccc(Cn2cc3c(n2)CN(/C(=N\C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C3)c2c1OC(C)(C)OC2=O |
| InChI | InChI=1S/C29H37N5O7/c1-10-17-11-12-18(21-22(17)38-29(8,9)39-23(21)35)14-34-15-19-13-33(16-20(19)32-34)24(30-25(36)40-27(2,3)4)31-26(37)41-28(5,6)7/h10-12,15H,1,13-14,16H2,2-9H3,(H,30,31,36,37) |
| InChIKey | OIUZNDJKTQCOCN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|