C47H51N2O+ — CID 176822722
1-methyl-2-(1,1,4,4,5-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-6-yl)-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium (PubChem CID 176822722) has the molecular formula C47H51N2O+ and a molecular weight of 659.94 g/mol. Its IUPAC name is 1-methyl-2-(1,1,4,4,5-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-6-yl)-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium.
| Compound Name | 1-methyl-2-(1,1,4,4,5-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-6-yl)-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium |
|---|---|
| PubChem CID | 176822722 |
| Molecular Formula | C47H51N2O+ |
| Molecular Weight | 659.94 g/mol |
| Exact Mass | 659.40 |
| IUPAC Name | 1-methyl-2-(1,1,4,4,5-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-6-yl)-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazol-1-ium |
| SMILES | Cc1c2c(c3c(oc4ccccc43)c1-c1n(-c3c(C(C)C)cc(-c4ccccc4)cc3C(C)C)c3ccccc3[n+]1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C47H51N2O/c1-28(2)34-26-32(31-18-12-11-13-19-31)27-35(29(3)4)43(34)49-37-22-16-15-21-36(37)48(10)45(49)39-30(5)41-42(47(8,9)25-24-46(41,6)7)40-33-20-14-17-23-38(33)50-44(39)40/h11-23,26-29H,24-25H2,1-10H3/q+1 |
| InChIKey | ZCSWOZQOMBPTTA-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.94 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|