C48H39N3 — CID 176825233
2-[9,9-dimethyl-7-(1,1,1',3,3,3',4',5',6',7',8'-undecadeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)fluoren-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 176825233) has the molecular formula C48H39N3 and a molecular weight of 668.93 g/mol. Its IUPAC name is 2-[9,9-dimethyl-7-(1,1,1',3,3,3',4',5',6',7',8'-undecadeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)fluoren-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[9,9-dimethyl-7-(1,1,1',3,3,3',4',5',6',7',8'-undecadeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)fluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 176825233 |
| Molecular Formula | C48H39N3 |
| Molecular Weight | 668.93 g/mol |
| Exact Mass | 668.38 |
| IUPAC Name | 2-[9,9-dimethyl-7-(1,1,1',3,3,3',4',5',6',7',8'-undecadeuteriospiro[cyclohexane-2,9'-fluorene]-2'-yl)fluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1c([2H])c([2H])c(-c3ccc4c(c3)C(C)(C)c3cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc3-4)c([2H])c1C21C([2H])([2H])CCCC1([2H])[2H] |
| InChI | InChI=1S/C48H39N3/c1-47(2)41-28-33(34-21-24-39-36-18-10-11-19-40(36)48(43(39)29-34)26-12-5-13-27-48)20-23-37(41)38-25-22-35(30-42(38)47)46-50-44(31-14-6-3-7-15-31)49-45(51-46)32-16-8-4-9-17-32/h3-4,6-11,14-25,28-30H,5,12-13,26-27H2,1-2H3/i10D,11D,18D,19D,21D,24D,26D2,27D2,29D |
| InChIKey | GYWHWLMQNAKWGP-DLPSYKKISA-N |
| XLogP | 12.08 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.93 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |