C24H23NO7S — CID 176878545
[2-(1-bicyclo[2.2.1]heptanylmethylsulfonyloxy)-1,3-dioxobenzo[de]isoquinolin-5-yl] 2-methylprop-2-enoate (PubChem CID 176878545) has the molecular formula C24H23NO7S and a molecular weight of 469.52 g/mol. Its IUPAC name is [2-(1-bicyclo[2.2.1]heptanylmethylsulfonyloxy)-1,3-dioxobenzo[de]isoquinolin-5-yl] 2-methylprop-2-enoate.
| Compound Name | [2-(1-bicyclo[2.2.1]heptanylmethylsulfonyloxy)-1,3-dioxobenzo[de]isoquinolin-5-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 176878545 |
| Molecular Formula | C24H23NO7S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | [2-(1-bicyclo[2.2.1]heptanylmethylsulfonyloxy)-1,3-dioxobenzo[de]isoquinolin-5-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc2c3c(cccc3c1)C(=O)N(OS(=O)(=O)CC13CCC(CC1)C3)C2=O |
| InChI | InChI=1S/C24H23NO7S/c1-14(2)23(28)31-17-10-16-4-3-5-18-20(16)19(11-17)22(27)25(21(18)26)32-33(29,30)13-24-8-6-15(12-24)7-9-24/h3-5,10-11,15H,1,6-9,12-13H2,2H3 |
| InChIKey | DGRLOCOQNHBLET-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|