C23H20Cl3F5N4O5 — CID 176882174
(2S,3R,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-[(2,2,2-trichloroacetyl)carbamoylamino]-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 176882174) has the molecular formula C23H20Cl3F5N4O5 and a molecular weight of 633.78 g/mol. Its IUPAC name is (2S,3R,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-[(2,2,2-trichloroacetyl)carbamoylamino]-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2S,3R,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-[(2,2,2-trichloroacetyl)carbamoylamino]-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 176882174 |
| Molecular Formula | C23H20Cl3F5N4O5 |
| Molecular Weight | 633.78 g/mol |
| Exact Mass | 632.04 |
| IUPAC Name | (2S,3R,4R,5S)-3-(3,4-difluoro-2-methoxyphenyl)-4,5-dimethyl-N-[2-[(2,2,2-trichloroacetyl)carbamoylamino]-4-pyridinyl]-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | COc1c([C@@H]2[C@@H](C(=O)Nc3ccnc(NC(=O)NC(=O)C(Cl)(Cl)Cl)c3)O[C@](C)(C(F)(F)F)[C@@H]2C)ccc(F)c1F |
| InChI | InChI=1S/C23H20Cl3F5N4O5/c1-9-14(11-4-5-12(27)15(28)16(11)39-3)17(40-21(9,2)23(29,30)31)18(36)33-10-6-7-32-13(8-10)34-20(38)35-19(37)22(24,25)26/h4-9,14,17H,1-3H3,(H3,32,33,34,35,36,37,38)/t9-,14-,17+,21+/m1/s1 |
| InChIKey | NLLRGTGZPJAXAA-UFFDUGNRSA-N |
| XLogP | 5.46 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.78 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|