C28H47BrO2 — CID 176943405
10-(bromomethyl)-3-(methoxymethoxy)-13-methyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 176943405) has the molecular formula C28H47BrO2 and a molecular weight of 495.59 g/mol. Its IUPAC name is 10-(bromomethyl)-3-(methoxymethoxy)-13-methyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 10-(bromomethyl)-3-(methoxymethoxy)-13-methyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 176943405 |
| Molecular Formula | C28H47BrO2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 10-(bromomethyl)-3-(methoxymethoxy)-13-methyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | COCOC1CCC2(CBr)C(=CCC3C2CCC2(C)C(CCCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C28H47BrO2/c1-20(2)7-5-6-8-21-10-12-25-24-11-9-22-17-23(31-19-30-4)13-16-28(22,18-29)26(24)14-15-27(21,25)3/h9,20-21,23-26H,5-8,10-19H2,1-4H3 |
| InChIKey | OOCZEIKWXNHMTC-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|