C24H32FO7S- — CID 177111098
3-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxypropane-1-sulfonate (PubChem CID 177111098) has the molecular formula C24H32FO7S- and a molecular weight of 483.58 g/mol. Its IUPAC name is 3-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxypropane-1-sulfonate.
| Compound Name | 3-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 177111098 |
| Molecular Formula | C24H32FO7S- |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 3-[4-fluoro-3-[2-methyl-1-(8-tricyclo[5.2.1.02,6]decanyloxy)propoxy]benzoyl]oxypropane-1-sulfonate |
| SMILES | CC(C)C(Oc1cc(C(=O)OCCCS(=O)(=O)[O-])ccc1F)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C24H33FO7S/c1-14(2)24(31-21-13-16-11-19(21)18-6-3-5-17(16)18)32-22-12-15(7-8-20(22)25)23(26)30-9-4-10-33(27,28)29/h7-8,12,14,16-19,21,24H,3-6,9-11,13H2,1-2H3,(H,27,28,29)/p-1 |
| InChIKey | BYIUXXBEEAKYFZ-UHFFFAOYSA-M |
| XLogP | 4.12 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|