C22H26FO6S- — CID 177111449
2-[4-fluoro-3-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]benzoyl]oxyethanesulfonate (PubChem CID 177111449) has the molecular formula C22H26FO6S- and a molecular weight of 437.51 g/mol. Its IUPAC name is 2-[4-fluoro-3-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]benzoyl]oxyethanesulfonate.
| Compound Name | 2-[4-fluoro-3-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]benzoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 177111449 |
| Molecular Formula | C22H26FO6S- |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[4-fluoro-3-[(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)oxy]benzoyl]oxyethanesulfonate |
| SMILES | CC1(Oc2cc(C(=O)OCCS(=O)(=O)[O-])ccc2F)CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C22H27FO6S/c1-22(11-15-9-16(22)20-13-3-2-12(8-13)19(15)20)29-18-10-14(4-5-17(18)23)21(24)28-6-7-30(25,26)27/h4-5,10,12-13,15-16,19-20H,2-3,6-9,11H2,1H3,(H,25,26,27)/p-1 |
| InChIKey | VKUJFSOBKPTDBM-UHFFFAOYSA-M |
| XLogP | 3.37 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|