C55H46N4O — CID 177128570
9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-[2-(2,6-diphenylphenyl)ethyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-6-methylcarbazole (PubChem CID 177128570) has the molecular formula C55H46N4O and a molecular weight of 779.00 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-[2-(2,6-diphenylphenyl)ethyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-6-methylcarbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-[2-(2,6-diphenylphenyl)ethyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-6-methylcarbazole |
|---|---|
| PubChem CID | 177128570 |
| Molecular Formula | C55H46N4O |
| Molecular Weight | 779.00 g/mol |
| Exact Mass | 778.37 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[3-[2-(2,6-diphenylphenyl)ethyl]-2H-benzimidazol-3-ium-2-id-1-yl]phenoxy]-6-methylcarbazole |
| SMILES | Cc1ccc2c(c1)c1ccc(Oc3cccc(-n4[c-][n+](CCc5c(-c6ccccc6)cccc5-c5ccccc5)c5ccccc54)c3)cc1n2-c1cc(C(C)(C)C)ccn1 |
| InChI | InChI=1S/C55H46N4O/c1-38-25-28-50-49(33-38)48-27-26-44(36-53(48)59(50)54-34-41(29-31-56-54)55(2,3)4)60-43-20-13-19-42(35-43)58-37-57(51-23-11-12-24-52(51)58)32-30-47-45(39-15-7-5-8-16-39)21-14-22-46(47)40-17-9-6-10-18-40/h5-29,31,33-36H,30,32H2,1-4H3 |
| InChIKey | CWNWCWCZOMFVFI-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.00 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|