C27H33Cl2N7S — CID 177139695
4-[(2S)-2-(3,5-dichloro-4-pyridinyl)propyl]-2-[5-(2-methylsulfanyl-2,6-diazaspiro[3.3]heptan-6-yl)pyrazine-2-carboximidoyl]aniline;ethane (PubChem CID 177139695) has the molecular formula C27H33Cl2N7S and a molecular weight of 558.58 g/mol. Its IUPAC name is 4-[(2S)-2-(3,5-dichloro-4-pyridinyl)propyl]-2-[5-(2-methylsulfanyl-2,6-diazaspiro[3.3]heptan-6-yl)pyrazine-2-carboximidoyl]aniline;ethane.
| Compound Name | 4-[(2S)-2-(3,5-dichloro-4-pyridinyl)propyl]-2-[5-(2-methylsulfanyl-2,6-diazaspiro[3.3]heptan-6-yl)pyrazine-2-carboximidoyl]aniline;ethane |
|---|---|
| PubChem CID | 177139695 |
| Molecular Formula | C27H33Cl2N7S |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | 4-[(2S)-2-(3,5-dichloro-4-pyridinyl)propyl]-2-[5-(2-methylsulfanyl-2,6-diazaspiro[3.3]heptan-6-yl)pyrazine-2-carboximidoyl]aniline;ethane |
| SMILES | CC.[H]/N=C(/c1cnc(N2CC3(CN(SC)C3)C2)cn1)c1cc(C[C@H](C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C25H27Cl2N7S.C2H6/c1-15(23-18(26)7-30-8-19(23)27)5-16-3-4-20(28)17(6-16)24(29)21-9-32-22(10-31-21)33-11-25(12-33)13-34(14-25)35-2;1-2/h3-4,6-10,15,29H,5,11-14,28H2,1-2H3;1-2H3/b29-24+;/t15-;/m0./s1 |
| InChIKey | QLKMMCGTHQVALV-BOJRZTKUSA-N |
| XLogP | 5.95 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|