C29H29NO4S — CID 177149490
N-cyclohexyl-4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-8-yl]benzenesulfonamide (PubChem CID 177149490) has the molecular formula C29H29NO4S and a molecular weight of 487.62 g/mol. Its IUPAC name is N-cyclohexyl-4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-8-yl]benzenesulfonamide.
| Compound Name | N-cyclohexyl-4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-8-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 177149490 |
| Molecular Formula | C29H29NO4S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | N-cyclohexyl-4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-8-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(c2cccc3cc(-c4ccccc4C)c(=O)oc23)C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H29NO4S/c1-20-15-17-24(18-16-20)35(32,33)30(23-11-4-3-5-12-23)27-14-8-10-22-19-26(29(31)34-28(22)27)25-13-7-6-9-21(25)2/h6-10,13-19,23H,3-5,11-12H2,1-2H3 |
| InChIKey | QPJHHGJWUMWCPZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|