C32H27NO6S — CID 177149592
N-[3-(2-methylphenyl)-2-oxochromen-6-yl]-N-(4-methylphenyl)sulfonyl-2-phenylmethoxyacetamide (PubChem CID 177149592) has the molecular formula C32H27NO6S and a molecular weight of 553.64 g/mol. Its IUPAC name is N-[3-(2-methylphenyl)-2-oxochromen-6-yl]-N-(4-methylphenyl)sulfonyl-2-phenylmethoxyacetamide.
| Compound Name | N-[3-(2-methylphenyl)-2-oxochromen-6-yl]-N-(4-methylphenyl)sulfonyl-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 177149592 |
| Molecular Formula | C32H27NO6S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | N-[3-(2-methylphenyl)-2-oxochromen-6-yl]-N-(4-methylphenyl)sulfonyl-2-phenylmethoxyacetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)COCc2ccccc2)c2ccc3oc(=O)c(-c4ccccc4C)cc3c2)cc1 |
| InChI | InChI=1S/C32H27NO6S/c1-22-12-15-27(16-13-22)40(36,37)33(31(34)21-38-20-24-9-4-3-5-10-24)26-14-17-30-25(18-26)19-29(32(35)39-30)28-11-7-6-8-23(28)2/h3-19H,20-21H2,1-2H3 |
| InChIKey | HPCWOGXEYUPHLY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|