C30H25NO6S2 — CID 177149610
4-methyl-N-[3-(4-methylphenyl)-2-oxochromen-6-yl]-N-(4-methylphenyl)sulfonylbenzenesulfonamide (PubChem CID 177149610) has the molecular formula C30H25NO6S2 and a molecular weight of 559.67 g/mol. Its IUPAC name is 4-methyl-N-[3-(4-methylphenyl)-2-oxochromen-6-yl]-N-(4-methylphenyl)sulfonylbenzenesulfonamide.
| Compound Name | 4-methyl-N-[3-(4-methylphenyl)-2-oxochromen-6-yl]-N-(4-methylphenyl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 177149610 |
| Molecular Formula | C30H25NO6S2 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | 4-methyl-N-[3-(4-methylphenyl)-2-oxochromen-6-yl]-N-(4-methylphenyl)sulfonylbenzenesulfonamide |
| SMILES | Cc1ccc(-c2cc3cc(N(S(=O)(=O)c4ccc(C)cc4)S(=O)(=O)c4ccc(C)cc4)ccc3oc2=O)cc1 |
| InChI | InChI=1S/C30H25NO6S2/c1-20-4-10-23(11-5-20)28-19-24-18-25(12-17-29(24)37-30(28)32)31(38(33,34)26-13-6-21(2)7-14-26)39(35,36)27-15-8-22(3)9-16-27/h4-19H,1-3H3 |
| InChIKey | OPQLFBZRWYKLSF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 101.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|