C24H19NO7S2 — CID 177149604
N-(3-formyl-2-oxochromen-6-yl)-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide (PubChem CID 177149604) has the molecular formula C24H19NO7S2 and a molecular weight of 497.55 g/mol. Its IUPAC name is N-(3-formyl-2-oxochromen-6-yl)-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide.
| Compound Name | N-(3-formyl-2-oxochromen-6-yl)-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 177149604 |
| Molecular Formula | C24H19NO7S2 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | N-(3-formyl-2-oxochromen-6-yl)-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(c2ccc3oc(=O)c(C=O)cc3c2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H19NO7S2/c1-16-3-8-21(9-4-16)33(28,29)25(34(30,31)22-10-5-17(2)6-11-22)20-7-12-23-18(14-20)13-19(15-26)24(27)32-23/h3-15H,1-2H3 |
| InChIKey | YVEPJEOKAMNHGI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 118.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|