C32H29NO8S2 — CID 177149465
N-[4-(3,3-dihydroxypropyl)phenyl]sulfonyl-4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]benzenesulfonamide (PubChem CID 177149465) has the molecular formula C32H29NO8S2 and a molecular weight of 619.72 g/mol. Its IUPAC name is N-[4-(3,3-dihydroxypropyl)phenyl]sulfonyl-4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]benzenesulfonamide.
| Compound Name | N-[4-(3,3-dihydroxypropyl)phenyl]sulfonyl-4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 177149465 |
| Molecular Formula | C32H29NO8S2 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.13 |
| IUPAC Name | N-[4-(3,3-dihydroxypropyl)phenyl]sulfonyl-4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(c2ccc3oc(=O)c(-c4ccccc4C)cc3c2)S(=O)(=O)c2ccc(CCC(O)O)cc2)cc1 |
| InChI | InChI=1S/C32H29NO8S2/c1-21-7-13-26(14-8-21)42(37,38)33(43(39,40)27-15-9-23(10-16-27)11-18-31(34)35)25-12-17-30-24(19-25)20-29(32(36)41-30)28-6-4-3-5-22(28)2/h3-10,12-17,19-20,31,34-35H,11,18H2,1-2H3 |
| InChIKey | OAEGEJCFWZYUPK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|