C30H25NO7S2 — CID 177149570
N-[3-(4-methoxyphenyl)-2-oxochromen-6-yl]-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide (PubChem CID 177149570) has the molecular formula C30H25NO7S2 and a molecular weight of 575.66 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)-2-oxochromen-6-yl]-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide.
| Compound Name | N-[3-(4-methoxyphenyl)-2-oxochromen-6-yl]-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 177149570 |
| Molecular Formula | C30H25NO7S2 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.11 |
| IUPAC Name | N-[3-(4-methoxyphenyl)-2-oxochromen-6-yl]-4-methyl-N-(4-methylphenyl)sulfonylbenzenesulfonamide |
| SMILES | COc1ccc(-c2cc3cc(N(S(=O)(=O)c4ccc(C)cc4)S(=O)(=O)c4ccc(C)cc4)ccc3oc2=O)cc1 |
| InChI | InChI=1S/C30H25NO7S2/c1-20-4-13-26(14-5-20)39(33,34)31(40(35,36)27-15-6-21(2)7-16-27)24-10-17-29-23(18-24)19-28(30(32)38-29)22-8-11-25(37-3)12-9-22/h4-19H,1-3H3 |
| InChIKey | SLHOSJPIDWXIRZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 110.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|