C25H23NO7S2 — CID 177149544
N-(2-hydroxyethylsulfonyl)-4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]benzenesulfonamide (PubChem CID 177149544) has the molecular formula C25H23NO7S2 and a molecular weight of 513.59 g/mol. Its IUPAC name is N-(2-hydroxyethylsulfonyl)-4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]benzenesulfonamide.
| Compound Name | N-(2-hydroxyethylsulfonyl)-4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 177149544 |
| Molecular Formula | C25H23NO7S2 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | N-(2-hydroxyethylsulfonyl)-4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(c2ccc3oc(=O)c(-c4ccccc4C)cc3c2)S(=O)(=O)CCO)cc1 |
| InChI | InChI=1S/C25H23NO7S2/c1-17-7-10-21(11-8-17)35(31,32)26(34(29,30)14-13-27)20-9-12-24-19(15-20)16-23(25(28)33-24)22-6-4-3-5-18(22)2/h3-12,15-16,27H,13-14H2,1-2H3 |
| InChIKey | FIKLCFMFHMCWAH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|