C31H23NO6S2 — CID 177149553
4-methyl-N-(4-methylphenyl)sulfonyl-N-[2-oxo-3-(2-phenylethynyl)chromen-6-yl]benzenesulfonamide (PubChem CID 177149553) has the molecular formula C31H23NO6S2 and a molecular weight of 569.66 g/mol. Its IUPAC name is 4-methyl-N-(4-methylphenyl)sulfonyl-N-[2-oxo-3-(2-phenylethynyl)chromen-6-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-(4-methylphenyl)sulfonyl-N-[2-oxo-3-(2-phenylethynyl)chromen-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 177149553 |
| Molecular Formula | C31H23NO6S2 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.10 |
| IUPAC Name | 4-methyl-N-(4-methylphenyl)sulfonyl-N-[2-oxo-3-(2-phenylethynyl)chromen-6-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(c2ccc3oc(=O)c(C#Cc4ccccc4)cc3c2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H23NO6S2/c1-22-8-15-28(16-9-22)39(34,35)32(40(36,37)29-17-10-23(2)11-18-29)27-14-19-30-26(21-27)20-25(31(33)38-30)13-12-24-6-4-3-5-7-24/h3-11,14-21H,1-2H3 |
| InChIKey | SQZQCZCPBLVDMH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 101.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|