C28H27NO4SSi — CID 177149475
4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]-N-(2-trimethylsilylethynyl)benzenesulfonamide (PubChem CID 177149475) has the molecular formula C28H27NO4SSi and a molecular weight of 501.68 g/mol. Its IUPAC name is 4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]-N-(2-trimethylsilylethynyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]-N-(2-trimethylsilylethynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 177149475 |
| Molecular Formula | C28H27NO4SSi |
| Molecular Weight | 501.68 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 4-methyl-N-[3-(2-methylphenyl)-2-oxochromen-6-yl]-N-(2-trimethylsilylethynyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C#C[Si](C)(C)C)c2ccc3oc(=O)c(-c4ccccc4C)cc3c2)cc1 |
| InChI | InChI=1S/C28H27NO4SSi/c1-20-10-13-24(14-11-20)34(31,32)29(16-17-35(3,4)5)23-12-15-27-22(18-23)19-26(28(30)33-27)25-9-7-6-8-21(25)2/h6-15,18-19H,1-5H3 |
| InChIKey | UHCKRGKMAUXFFW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.68 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|